C17H19N3 — CID 67835553
isoquinoline;N'-phenylethane-1,2-diamine (PubChem CID 67835553) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is isoquinoline;N'-phenylethane-1,2-diamine.
| Compound Name | isoquinoline;N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 67835553 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | isoquinoline;N'-phenylethane-1,2-diamine |
| SMILES | NCCNc1ccccc1.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C8H12N2/c1-2-4-9-7-10-6-5-8(9)3-1;9-6-7-10-8-4-2-1-3-5-8/h1-7H;1-5,10H,6-7,9H2 |
| InChIKey | CEWQXXCTNFYCFV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |