C13H19N3O — CID 81061309
4-(3-ethoxypropylamino)-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 81061309) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(3-ethoxypropylamino)-2,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 4-(3-ethoxypropylamino)-2,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 81061309 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-(3-ethoxypropylamino)-2,6-dimethylpyridine-3-carbonitrile |
| SMILES | CCOCCCNc1cc(C)nc(C)c1C#N |
| InChI | InChI=1S/C13H19N3O/c1-4-17-7-5-6-15-13-8-10(2)16-11(3)12(13)9-14/h8H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | GVUMYKHVNUNGAT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|