C13H15N3O — CID 58445511
3-(3-ethoxypropylamino)benzene-1,2-dicarbonitrile (PubChem CID 58445511) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(3-ethoxypropylamino)benzene-1,2-dicarbonitrile.
| Compound Name | 3-(3-ethoxypropylamino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 58445511 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-(3-ethoxypropylamino)benzene-1,2-dicarbonitrile |
| SMILES | CCOCCCNc1cccc(C#N)c1C#N |
| InChI | InChI=1S/C13H15N3O/c1-2-17-8-4-7-16-13-6-3-5-11(9-14)12(13)10-15/h3,5-6,16H,2,4,7-8H2,1H3 |
| InChIKey | WVDZWMCCPVEIFL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|