C16H19N3O2 — CID 133395706
4-[3-(furan-2-ylmethoxy)propylamino]-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 133395706) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-[3-(furan-2-ylmethoxy)propylamino]-2,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 4-[3-(furan-2-ylmethoxy)propylamino]-2,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133395706 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-[3-(furan-2-ylmethoxy)propylamino]-2,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(NCCCOCc2ccco2)c(C#N)c(C)n1 |
| InChI | InChI=1S/C16H19N3O2/c1-12-9-16(15(10-17)13(2)19-12)18-6-4-7-20-11-14-5-3-8-21-14/h3,5,8-9H,4,6-7,11H2,1-2H3,(H,18,19) |
| InChIKey | KHEHURJEHIVIKP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|