C17H22ClN3O2S — CID 133433966
7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine (PubChem CID 133433966) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine.
| Compound Name | 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine |
|---|---|
| PubChem CID | 133433966 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine |
| SMILES | Cc1c(Cl)ccc2ccc(NCCCN3CCS(=O)(=O)CC3)nc12 |
| InChI | InChI=1S/C17H22ClN3O2S/c1-13-15(18)5-3-14-4-6-16(20-17(13)14)19-7-2-8-21-9-11-24(22,23)12-10-21/h3-6H,2,7-12H2,1H3,(H,19,20) |
| InChIKey | UGMBLTZKAWLIOG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|