About 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine
7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine (PubChem CID 133433966) has the molecular formula C17H22ClN3O2S
and a molecular weight of 367.90 g/mol. Its IUPAC name is 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine.
Molecular Properties
| Compound Name | 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine |
| PubChem CID | 133433966 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine |
| SMILES | Cc1c(Cl)ccc2ccc(NCCCN3CCS(=O)(=O)CC3)nc12 |
| InChI | InChI=1S/C17H22ClN3O2S/c1-13-15(18)5-3-14-4-6-16(20-17(13)14)19-7-2-8-21-9-11-24(22,23)12-10-21/h3-6H,2,7-12H2,1H3,(H,19,20) |
| InChIKey | UGMBLTZKAWLIOG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine?
The IUPAC name of 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine (CID 133433966) is 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine.
What is the SMILES notation for 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine?
The canonical SMILES for 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine is Cc1c(Cl)ccc2ccc(NCCCN3CCS(=O)(=O)CC3)nc12.
What is the InChIKey of 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine?
The InChIKey is UGMBLTZKAWLIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClN3O2S/c1-13-15(18)5-3-14-4-6-16(20-17(13)14)19-7-2-8-21-9-11-24(22,23)12-10-21/h3-6H,2,7-12H2,1H3,(H,19,20).
What are the key properties of 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine?
7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine has a molecular weight of 367.90 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-8-methylquinolin-2-amine is sourced from PubChem (CID 133433966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).