C18H25N5O3S — CID 137272392
2-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one (PubChem CID 137272392) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137272392 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-[6-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-c2ccc(NCCCN3CCS(=O)(=O)CC3)nc2)n1 |
| InChI | InChI=1S/C18H25N5O3S/c1-2-15-12-17(24)22-18(21-15)14-4-5-16(20-13-14)19-6-3-7-23-8-10-27(25,26)11-9-23/h4-5,12-13H,2-3,6-11H2,1H3,(H,19,20)(H,21,22,24) |
| InChIKey | NIMTWPXDMYUMNS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|