C16H20N4O3 — CID 137098081
(2R)-2-[[5-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-2-pyridinyl]amino]-3-methylbutanoic acid (PubChem CID 137098081) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (2R)-2-[[5-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-2-pyridinyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[5-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-2-pyridinyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 137098081 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (2R)-2-[[5-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-2-pyridinyl]amino]-3-methylbutanoic acid |
| SMILES | CCc1cc(=O)[nH]c(-c2ccc(N[C@@H](C(=O)O)C(C)C)nc2)n1 |
| InChI | InChI=1S/C16H20N4O3/c1-4-11-7-13(21)20-15(18-11)10-5-6-12(17-8-10)19-14(9(2)3)16(22)23/h5-9,14H,4H2,1-3H3,(H,17,19)(H,22,23)(H,18,20,21)/t14-/m1/s1 |
| InChIKey | QCZALNJRPARWNU-CQSZACIVSA-N |
| XLogP | 1.92 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |