C21H24N4O2 — CID 137267445
4-ethyl-2-[6-[(3-hydroxy-3-phenylbutyl)amino]-3-pyridinyl]-1H-pyrimidin-6-one (PubChem CID 137267445) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-ethyl-2-[6-[(3-hydroxy-3-phenylbutyl)amino]-3-pyridinyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[6-[(3-hydroxy-3-phenylbutyl)amino]-3-pyridinyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137267445 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-ethyl-2-[6-[(3-hydroxy-3-phenylbutyl)amino]-3-pyridinyl]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-c2ccc(NCCC(C)(O)c3ccccc3)nc2)n1 |
| InChI | InChI=1S/C21H24N4O2/c1-3-17-13-19(26)25-20(24-17)15-9-10-18(23-14-15)22-12-11-21(2,27)16-7-5-4-6-8-16/h4-10,13-14,27H,3,11-12H2,1-2H3,(H,22,23)(H,24,25,26) |
| InChIKey | IJODOHMOORAYMK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |