C17H22N4O2 — CID 136714200
4-ethyl-2-[6-[2-[(2S)-oxolan-2-yl]ethylamino]-3-pyridinyl]-1H-pyrimidin-6-one (PubChem CID 136714200) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-ethyl-2-[6-[2-[(2S)-oxolan-2-yl]ethylamino]-3-pyridinyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[6-[2-[(2S)-oxolan-2-yl]ethylamino]-3-pyridinyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136714200 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-ethyl-2-[6-[2-[(2S)-oxolan-2-yl]ethylamino]-3-pyridinyl]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-c2ccc(NCC[C@@H]3CCCO3)nc2)n1 |
| InChI | InChI=1S/C17H22N4O2/c1-2-13-10-16(22)21-17(20-13)12-5-6-15(19-11-12)18-8-7-14-4-3-9-23-14/h5-6,10-11,14H,2-4,7-9H2,1H3,(H,18,19)(H,20,21,22)/t14-/m0/s1 |
| InChIKey | GSWMXXXVHFKVMX-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |