C22H24N4O2 — CID 137258186
2-[6-[(2-cyclobutyloxyphenyl)methylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one (PubChem CID 137258186) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[6-[(2-cyclobutyloxyphenyl)methylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[6-[(2-cyclobutyloxyphenyl)methylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137258186 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[6-[(2-cyclobutyloxyphenyl)methylamino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-c2ccc(NCc3ccccc3OC3CCC3)nc2)n1 |
| InChI | InChI=1S/C22H24N4O2/c1-2-17-12-21(27)26-22(25-17)16-10-11-20(24-14-16)23-13-15-6-3-4-9-19(15)28-18-7-5-8-18/h3-4,6,9-12,14,18H,2,5,7-8,13H2,1H3,(H,23,24)(H,25,26,27) |
| InChIKey | KIXAQDPGVNGASL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |