C19H19ClN4O2 — CID 137257636
2-[6-[[1-(4-chlorophenyl)-2-hydroxyethyl]amino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one (PubChem CID 137257636) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[6-[[1-(4-chlorophenyl)-2-hydroxyethyl]amino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[6-[[1-(4-chlorophenyl)-2-hydroxyethyl]amino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137257636 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[6-[[1-(4-chlorophenyl)-2-hydroxyethyl]amino]-3-pyridinyl]-4-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(-c2ccc(NC(CO)c3ccc(Cl)cc3)nc2)n1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-2-15-9-18(26)24-19(22-15)13-5-8-17(21-10-13)23-16(11-25)12-3-6-14(20)7-4-12/h3-10,16,25H,2,11H2,1H3,(H,21,23)(H,22,24,26) |
| InChIKey | QZSRBDDFLSGTCF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |