C15H21FN2O3S — CID 133433973
1-[2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-6-fluorophenyl]ethanone (PubChem CID 133433973) has the molecular formula C15H21FN2O3S and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-[2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-6-fluorophenyl]ethanone.
| Compound Name | 1-[2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-6-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 133433973 |
| Molecular Formula | C15H21FN2O3S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-6-fluorophenyl]ethanone |
| SMILES | CC(=O)c1c(F)cccc1NCCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H21FN2O3S/c1-12(19)15-13(16)4-2-5-14(15)17-6-3-7-18-8-10-22(20,21)11-9-18/h2,4-5,17H,3,6-11H2,1H3 |
| InChIKey | XGISIQCPVICGGC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|