C20H33N3O3S — CID 167903050
1-[2-(3-tert-butylphenyl)ethyl]-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea (PubChem CID 167903050) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-[2-(3-tert-butylphenyl)ethyl]-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea.
| Compound Name | 1-[2-(3-tert-butylphenyl)ethyl]-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea |
|---|---|
| PubChem CID | 167903050 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[2-(3-tert-butylphenyl)ethyl]-3-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]urea |
| SMILES | CC(C)(C)c1cccc(CCNC(=O)NCCCN2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C20H33N3O3S/c1-20(2,3)18-7-4-6-17(16-18)8-10-22-19(24)21-9-5-11-23-12-14-27(25,26)15-13-23/h4,6-7,16H,5,8-15H2,1-3H3,(H2,21,22,24) |
| InChIKey | UDVVORPFLZHFSF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|