C17H27N3O3 — CID 99816188
1-[2-(3-hydroxyphenyl)ethyl]-3-(4-morpholin-4-ylbutyl)urea (PubChem CID 99816188) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[2-(3-hydroxyphenyl)ethyl]-3-(4-morpholin-4-ylbutyl)urea.
| Compound Name | 1-[2-(3-hydroxyphenyl)ethyl]-3-(4-morpholin-4-ylbutyl)urea |
|---|---|
| PubChem CID | 99816188 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-[2-(3-hydroxyphenyl)ethyl]-3-(4-morpholin-4-ylbutyl)urea |
| SMILES | O=C(NCCCCN1CCOCC1)NCCc1cccc(O)c1 |
| InChI | InChI=1S/C17H27N3O3/c21-16-5-3-4-15(14-16)6-8-19-17(22)18-7-1-2-9-20-10-12-23-13-11-20/h3-5,14,21H,1-2,6-13H2,(H2,18,19,22) |
| InChIKey | MCMOORHOFDLWLD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|