C17H27NO2 — CID 157372388
2-methylpropyl N-[2-(3-tert-butylphenyl)ethyl]carbamate (PubChem CID 157372388) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-methylpropyl N-[2-(3-tert-butylphenyl)ethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-(3-tert-butylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 157372388 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-methylpropyl N-[2-(3-tert-butylphenyl)ethyl]carbamate |
| SMILES | CC(C)COC(=O)NCCc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H27NO2/c1-13(2)12-20-16(19)18-10-9-14-7-6-8-15(11-14)17(3,4)5/h6-8,11,13H,9-10,12H2,1-5H3,(H,18,19) |
| InChIKey | BJXNCMVMJMCCDO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |