C22H28N4O5S — CID 126721346
1-benzyl-5-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide (PubChem CID 126721346) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-benzyl-5-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-5-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 126721346 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-benzyl-5-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCN2CCS(=O)(=O)CC2)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H28N4O5S/c1-23-21(28)19-14-18(16-26(22(19)29)15-17-6-3-2-4-7-17)20(27)24-8-5-9-25-10-12-32(30,31)13-11-25/h2-4,6-7,14,16H,5,8-13,15H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | QBHIEALMUASAES-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|