C25H34N4O3 — CID 163805471
1-benzyl-2-oxo-5-N-[3-(1-propylpiperidin-4-yl)propyl]pyridine-3,5-dicarboxamide (PubChem CID 163805471) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-benzyl-2-oxo-5-N-[3-(1-propylpiperidin-4-yl)propyl]pyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-2-oxo-5-N-[3-(1-propylpiperidin-4-yl)propyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 163805471 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-benzyl-2-oxo-5-N-[3-(1-propylpiperidin-4-yl)propyl]pyridine-3,5-dicarboxamide |
| SMILES | CCCN1CCC(CCCNC(=O)c2cc(C(N)=O)c(=O)n(Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H34N4O3/c1-2-13-28-14-10-19(11-15-28)9-6-12-27-24(31)21-16-22(23(26)30)25(32)29(18-21)17-20-7-4-3-5-8-20/h3-5,7-8,16,18-19H,2,6,9-15,17H2,1H3,(H2,26,30)(H,27,31) |
| InChIKey | NIQOEYGLPAPFFJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|