C26H34N4O3 — CID 145279448
5-[1-[3-(1-acetylpiperidin-4-yl)propylamino]ethenyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide (PubChem CID 145279448) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 5-[1-[3-(1-acetylpiperidin-4-yl)propylamino]ethenyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | 5-[1-[3-(1-acetylpiperidin-4-yl)propylamino]ethenyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 145279448 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 5-[1-[3-(1-acetylpiperidin-4-yl)propylamino]ethenyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide |
| SMILES | C=C(NCCCC1CCN(C(C)=O)CC1)c1cc(C(=O)NC)c(=O)n(Cc2ccccc2)c1 |
| InChI | InChI=1S/C26H34N4O3/c1-19(28-13-7-10-21-11-14-29(15-12-21)20(2)31)23-16-24(25(32)27-3)26(33)30(18-23)17-22-8-5-4-6-9-22/h4-6,8-9,16,18,21,28H,1,7,10-15,17H2,2-3H3,(H,27,32) |
| InChIKey | ISNYXJUXUANLJR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|