C26H33N3O4 — CID 148828457
5-[5-(1-acetylpiperidin-4-yl)pentanoyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide (PubChem CID 148828457) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 5-[5-(1-acetylpiperidin-4-yl)pentanoyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | 5-[5-(1-acetylpiperidin-4-yl)pentanoyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 148828457 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 5-[5-(1-acetylpiperidin-4-yl)pentanoyl]-1-benzyl-N-methyl-2-oxopyridine-3-carboxamide |
| SMILES | CNC(=O)c1cc(C(=O)CCCCC2CCN(C(C)=O)CC2)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C26H33N3O4/c1-19(30)28-14-12-20(13-15-28)8-6-7-11-24(31)22-16-23(25(32)27-2)26(33)29(18-22)17-21-9-4-3-5-10-21/h3-5,9-10,16,18,20H,6-8,11-15,17H2,1-2H3,(H,27,32) |
| InChIKey | OTEWGFYXHYTUEL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|