C25H33FN4O3 — CID 126739590
1-benzyl-5-N-[3-[1-(2-fluoroethyl)piperidin-4-yl]propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide (PubChem CID 126739590) has the molecular formula C25H33FN4O3 and a molecular weight of 456.56 g/mol. Its IUPAC name is 1-benzyl-5-N-[3-[1-(2-fluoroethyl)piperidin-4-yl]propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-5-N-[3-[1-(2-fluoroethyl)piperidin-4-yl]propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 126739590 |
| Molecular Formula | C25H33FN4O3 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-benzyl-5-N-[3-[1-(2-fluoroethyl)piperidin-4-yl]propyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCC2CCN(CCF)CC2)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C25H33FN4O3/c1-27-24(32)22-16-21(18-30(25(22)33)17-20-6-3-2-4-7-20)23(31)28-12-5-8-19-9-13-29(14-10-19)15-11-26/h2-4,6-7,16,18-19H,5,8-15,17H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | KEGLKEQPKMWHRE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|