C27H36N4O6 — CID 126721219
tert-butyl 2-[3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propyl]morpholine-4-carboxylate (PubChem CID 126721219) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is tert-butyl 2-[3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 126721219 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | tert-butyl 2-[3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propyl]morpholine-4-carboxylate |
| SMILES | CNC(=O)c1cc(C(=O)NCCCC2CN(C(=O)OC(C)(C)C)CCO2)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C27H36N4O6/c1-27(2,3)37-26(35)30-13-14-36-21(18-30)11-8-12-29-23(32)20-15-22(24(33)28-4)25(34)31(17-20)16-19-9-6-5-7-10-19/h5-7,9-10,15,17,21H,8,11-14,16,18H2,1-4H3,(H,28,33)(H,29,32) |
| InChIKey | WLWJZUNPOSEWSJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|