C19H22N4O5 — CID 135341859
3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propylcarbamic acid (PubChem CID 135341859) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 135341859 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-[[1-benzyl-5-(methylcarbamoyl)-6-oxopyridine-3-carbonyl]amino]propylcarbamic acid |
| SMILES | CNC(=O)c1cc(C(=O)NCCCNC(=O)O)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H22N4O5/c1-20-17(25)15-10-14(16(24)21-8-5-9-22-19(27)28)12-23(18(15)26)11-13-6-3-2-4-7-13/h2-4,6-7,10,12,22H,5,8-9,11H2,1H3,(H,20,25)(H,21,24)(H,27,28) |
| InChIKey | AOCGRWXIKYRYIG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|