C26H32N4O3 — CID 161110422
1-(1H-indol-4-ylmethyl)-N-methyl-2-oxo-5-(5-piperidin-4-ylpentanoyl)pyridine-3-carboxamide (PubChem CID 161110422) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-(1H-indol-4-ylmethyl)-N-methyl-2-oxo-5-(5-piperidin-4-ylpentanoyl)pyridine-3-carboxamide.
| Compound Name | 1-(1H-indol-4-ylmethyl)-N-methyl-2-oxo-5-(5-piperidin-4-ylpentanoyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 161110422 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-(1H-indol-4-ylmethyl)-N-methyl-2-oxo-5-(5-piperidin-4-ylpentanoyl)pyridine-3-carboxamide |
| SMILES | CNC(=O)c1cc(C(=O)CCCCC2CCNCC2)cn(Cc2cccc3[nH]ccc23)c1=O |
| InChI | InChI=1S/C26H32N4O3/c1-27-25(32)22-15-20(24(31)8-3-2-5-18-9-12-28-13-10-18)17-30(26(22)33)16-19-6-4-7-23-21(19)11-14-29-23/h4,6-7,11,14-15,17-18,28-29H,2-3,5,8-10,12-13,16H2,1H3,(H,27,32) |
| InChIKey | UJPSMXIKKRXDFQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|