C17H16N4O3 — CID 126676411
1-(1H-indol-4-ylmethyl)-3-N-methyl-2-oxopyridine-3,5-dicarboxamide (PubChem CID 126676411) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-(1H-indol-4-ylmethyl)-3-N-methyl-2-oxopyridine-3,5-dicarboxamide.
| Compound Name | 1-(1H-indol-4-ylmethyl)-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 126676411 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(1H-indol-4-ylmethyl)-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(N)=O)cn(Cc2cccc3[nH]ccc23)c1=O |
| InChI | InChI=1S/C17H16N4O3/c1-19-16(23)13-7-11(15(18)22)9-21(17(13)24)8-10-3-2-4-14-12(10)5-6-20-14/h2-7,9,20H,8H2,1H3,(H2,18,22)(H,19,23) |
| InChIKey | GHDARRYKLITDCL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |