C16H15ClN4O — CID 143999736
6-chloro-4-(1H-indol-4-ylmethylamino)-N-methylpyridine-3-carboxamide (PubChem CID 143999736) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 6-chloro-4-(1H-indol-4-ylmethylamino)-N-methylpyridine-3-carboxamide.
| Compound Name | 6-chloro-4-(1H-indol-4-ylmethylamino)-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 143999736 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-chloro-4-(1H-indol-4-ylmethylamino)-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(Cl)cc1NCc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C16H15ClN4O/c1-18-16(22)12-9-21-15(17)7-14(12)20-8-10-3-2-4-13-11(10)5-6-19-13/h2-7,9,19H,8H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | KCJJWIKKPVGOOF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|