C15H12Cl2N2O — CID 107679377
2,6-dichloro-4-(1H-indol-4-ylmethylamino)phenol (PubChem CID 107679377) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 2,6-dichloro-4-(1H-indol-4-ylmethylamino)phenol.
| Compound Name | 2,6-dichloro-4-(1H-indol-4-ylmethylamino)phenol |
|---|---|
| PubChem CID | 107679377 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2,6-dichloro-4-(1H-indol-4-ylmethylamino)phenol |
| SMILES | Oc1c(Cl)cc(NCc2cccc3[nH]ccc23)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O/c16-12-6-10(7-13(17)15(12)20)19-8-9-2-1-3-14-11(9)4-5-18-14/h1-7,18-20H,8H2 |
| InChIKey | OTYVVYDLUKFUED-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|