C14H14ClN3OS — CID 58440080
6-chloro-4-[(2-methylsulfanylphenyl)methylamino]pyridine-3-carboxamide (PubChem CID 58440080) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 6-chloro-4-[(2-methylsulfanylphenyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[(2-methylsulfanylphenyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58440080 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 6-chloro-4-[(2-methylsulfanylphenyl)methylamino]pyridine-3-carboxamide |
| SMILES | CSc1ccccc1CNc1cc(Cl)ncc1C(N)=O |
| InChI | InChI=1S/C14H14ClN3OS/c1-20-12-5-3-2-4-9(12)7-17-11-6-13(15)18-8-10(11)14(16)19/h2-6,8H,7H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | CYYCXGBDHNPHGK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|