C15H16ClN3O2 — CID 58440318
6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]pyridine-3-carboxamide (PubChem CID 58440318) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58440318 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]pyridine-3-carboxamide |
| SMILES | CCc1c(CO)cccc1Nc1cc(Cl)ncc1C(N)=O |
| InChI | InChI=1S/C15H16ClN3O2/c1-2-10-9(8-20)4-3-5-12(10)19-13-6-14(16)18-7-11(13)15(17)21/h3-7,20H,2,8H2,1H3,(H2,17,21)(H,18,19) |
| InChIKey | ZXTKBGWIIOMAAL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|