C13H9ClF3N3O — CID 58440060
6-chloro-4-[(2,3,6-trifluorophenyl)methylamino]pyridine-3-carboxamide (PubChem CID 58440060) has the molecular formula C13H9ClF3N3O and a molecular weight of 315.68 g/mol. Its IUPAC name is 6-chloro-4-[(2,3,6-trifluorophenyl)methylamino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[(2,3,6-trifluorophenyl)methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58440060 |
| Molecular Formula | C13H9ClF3N3O |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 6-chloro-4-[(2,3,6-trifluorophenyl)methylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Cl)cc1NCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C13H9ClF3N3O/c14-11-3-10(7(5-20-11)13(18)21)19-4-6-8(15)1-2-9(16)12(6)17/h1-3,5H,4H2,(H2,18,21)(H,19,20) |
| InChIKey | HVXPNNQRTGWAIE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|