C16H14ClIN4O — CID 89065817
6-chloro-4-[[2-(1λ3,2-iodazol-1-yl)phenyl]methylamino]pyridine-3-carboxamide (PubChem CID 89065817) has the molecular formula C16H14ClIN4O and a molecular weight of 440.67 g/mol. Its IUPAC name is 6-chloro-4-[[2-(1λ3,2-iodazol-1-yl)phenyl]methylamino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[[2-(1λ3,2-iodazol-1-yl)phenyl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89065817 |
| Molecular Formula | C16H14ClIN4O |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | 6-chloro-4-[[2-(1λ3,2-iodazol-1-yl)phenyl]methylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Cl)cc1NCc1ccccc1I1C=CC=N1 |
| InChI | InChI=1S/C16H14ClIN4O/c17-15-8-14(12(10-21-15)16(19)23)20-9-11-4-1-2-5-13(11)18-6-3-7-22-18/h1-8,10H,9H2,(H2,19,23)(H,20,21) |
| InChIKey | HTVOCJAQYNVVMS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|