C14H14ClN3O — CID 76789381
6-chloro-4-(1-phenylethylamino)pyridine-3-carboxamide (PubChem CID 76789381) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 6-chloro-4-(1-phenylethylamino)pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-(1-phenylethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 76789381 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 6-chloro-4-(1-phenylethylamino)pyridine-3-carboxamide |
| SMILES | CC(Nc1cc(Cl)ncc1C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C14H14ClN3O/c1-9(10-5-3-2-4-6-10)18-12-7-13(15)17-8-11(12)14(16)19/h2-9H,1H3,(H2,16,19)(H,17,18) |
| InChIKey | LVKKADXYMSEPPU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|