C16H18ClN3O3 — CID 90135455
6-chloro-4-[[(1S,2S)-2,3-dihydroxy-1-phenylpropyl]amino]-N-methylpyridine-3-carboxamide (PubChem CID 90135455) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 6-chloro-4-[[(1S,2S)-2,3-dihydroxy-1-phenylpropyl]amino]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[[(1S,2S)-2,3-dihydroxy-1-phenylpropyl]amino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 90135455 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 6-chloro-4-[[(1S,2S)-2,3-dihydroxy-1-phenylpropyl]amino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(Cl)cc1N[C@@H](c1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C16H18ClN3O3/c1-18-16(23)11-8-19-14(17)7-12(11)20-15(13(22)9-21)10-5-3-2-4-6-10/h2-8,13,15,21-22H,9H2,1H3,(H,18,23)(H,19,20)/t13-,15+/m1/s1 |
| InChIKey | CJGTWKZWEFDNCF-HIFRSBDPSA-N |
| XLogP | 1.60 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|