C16H16ClN3O5 — CID 87717595
methyl 6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]-5-nitropyridine-3-carboxylate (PubChem CID 87717595) has the molecular formula C16H16ClN3O5 and a molecular weight of 365.77 g/mol. Its IUPAC name is methyl 6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]-5-nitropyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 87717595 |
| Molecular Formula | C16H16ClN3O5 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | methyl 6-chloro-4-[2-ethyl-3-(hydroxymethyl)anilino]-5-nitropyridine-3-carboxylate |
| SMILES | CCc1c(CO)cccc1Nc1c(C(=O)OC)cnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16ClN3O5/c1-3-10-9(8-21)5-4-6-12(10)19-13-11(16(22)25-2)7-18-15(17)14(13)20(23)24/h4-7,21H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | DEONWSOTEIAMEU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|