C27H36N4O4 — CID 22170238
7-[3-(diethylamino)propoxy]-4-[2-ethyl-3-(hydroxymethyl)anilino]-6-methoxyquinoline-3-carboxamide (PubChem CID 22170238) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is 7-[3-(diethylamino)propoxy]-4-[2-ethyl-3-(hydroxymethyl)anilino]-6-methoxyquinoline-3-carboxamide.
| Compound Name | 7-[3-(diethylamino)propoxy]-4-[2-ethyl-3-(hydroxymethyl)anilino]-6-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22170238 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 7-[3-(diethylamino)propoxy]-4-[2-ethyl-3-(hydroxymethyl)anilino]-6-methoxyquinoline-3-carboxamide |
| SMILES | CCc1c(CO)cccc1Nc1c(C(N)=O)cnc2cc(OCCCN(CC)CC)c(OC)cc12 |
| InChI | InChI=1S/C27H36N4O4/c1-5-19-18(17-32)10-8-11-22(19)30-26-20-14-24(34-4)25(35-13-9-12-31(6-2)7-3)15-23(20)29-16-21(26)27(28)33/h8,10-11,14-16,32H,5-7,9,12-13,17H2,1-4H3,(H2,28,33)(H,29,30) |
| InChIKey | OXQJXSDJADIIBP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|