C26H25N3O4 — CID 10114344
4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxy-6-phenylmethoxyquinoline-3-carboxamide (PubChem CID 10114344) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxy-6-phenylmethoxyquinoline-3-carboxamide.
| Compound Name | 4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxy-6-phenylmethoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10114344 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxy-6-phenylmethoxyquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3cccc(CO)c3C)c2cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H25N3O4/c1-16-18(14-30)9-6-10-21(16)29-25-19-11-24(33-15-17-7-4-3-5-8-17)23(32-2)12-22(19)28-13-20(25)26(27)31/h3-13,30H,14-15H2,1-2H3,(H2,27,31)(H,28,29) |
| InChIKey | NSEIFVLEVTZPMT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |