C19H19N3O4 — CID 10269479
6-hydroxy-4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxyquinoline-3-carboxamide (PubChem CID 10269479) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 6-hydroxy-4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxyquinoline-3-carboxamide.
| Compound Name | 6-hydroxy-4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10269479 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 6-hydroxy-4-[3-(hydroxymethyl)-2-methylanilino]-7-methoxyquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3cccc(CO)c3C)c2cc1O |
| InChI | InChI=1S/C19H19N3O4/c1-10-11(9-23)4-3-5-14(10)22-18-12-6-16(24)17(26-2)7-15(12)21-8-13(18)19(20)25/h3-8,23-24H,9H2,1-2H3,(H2,20,25)(H,21,22) |
| InChIKey | CAGYKCOTGKSBER-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |