C28H36N4O5 — CID 67550766
7-[3-[(2S)-2,6-dimethylmorpholin-2-yl]propoxy]-4-[3-(hydroxymethyl)-2-methylanilino]-6-methoxyquinoline-3-carboxamide (PubChem CID 67550766) has the molecular formula C28H36N4O5 and a molecular weight of 508.62 g/mol. Its IUPAC name is 7-[3-[(2S)-2,6-dimethylmorpholin-2-yl]propoxy]-4-[3-(hydroxymethyl)-2-methylanilino]-6-methoxyquinoline-3-carboxamide.
| Compound Name | 7-[3-[(2S)-2,6-dimethylmorpholin-2-yl]propoxy]-4-[3-(hydroxymethyl)-2-methylanilino]-6-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 67550766 |
| Molecular Formula | C28H36N4O5 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 7-[3-[(2S)-2,6-dimethylmorpholin-2-yl]propoxy]-4-[3-(hydroxymethyl)-2-methylanilino]-6-methoxyquinoline-3-carboxamide |
| SMILES | COc1cc2c(Nc3cccc(CO)c3C)c(C(N)=O)cnc2cc1OCCC[C@@]1(C)CNCC(C)O1 |
| InChI | InChI=1S/C28H36N4O5/c1-17-13-30-16-28(3,37-17)9-6-10-36-25-12-23-20(11-24(25)35-4)26(21(14-31-23)27(29)34)32-22-8-5-7-19(15-33)18(22)2/h5,7-8,11-12,14,17,30,33H,6,9-10,13,15-16H2,1-4H3,(H2,29,34)(H,31,32)/t17?,28-/m0/s1 |
| InChIKey | ZUIVUYBOEYKQBV-SNCIIYAQSA-N |
| XLogP | 3.81 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|