C22H26N4O3 — CID 10178758
7-(3-aminopropoxy)-4-(2-ethylanilino)-6-methoxyquinoline-3-carboxamide (PubChem CID 10178758) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 7-(3-aminopropoxy)-4-(2-ethylanilino)-6-methoxyquinoline-3-carboxamide.
| Compound Name | 7-(3-aminopropoxy)-4-(2-ethylanilino)-6-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10178758 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 7-(3-aminopropoxy)-4-(2-ethylanilino)-6-methoxyquinoline-3-carboxamide |
| SMILES | CCc1ccccc1Nc1c(C(N)=O)cnc2cc(OCCCN)c(OC)cc12 |
| InChI | InChI=1S/C22H26N4O3/c1-3-14-7-4-5-8-17(14)26-21-15-11-19(28-2)20(29-10-6-9-23)12-18(15)25-13-16(21)22(24)27/h4-5,7-8,11-13H,3,6,9-10,23H2,1-2H3,(H2,24,27)(H,25,26) |
| InChIKey | LDKOYZUGKAJTLV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|