C24H31N3O3 — CID 141057651
[3-[[7-[3-(dimethylamino)propoxy]-6-methoxyquinolin-4-yl]amino]-2-ethylphenyl]methanol (PubChem CID 141057651) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is [3-[[7-[3-(dimethylamino)propoxy]-6-methoxyquinolin-4-yl]amino]-2-ethylphenyl]methanol.
| Compound Name | [3-[[7-[3-(dimethylamino)propoxy]-6-methoxyquinolin-4-yl]amino]-2-ethylphenyl]methanol |
|---|---|
| PubChem CID | 141057651 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | [3-[[7-[3-(dimethylamino)propoxy]-6-methoxyquinolin-4-yl]amino]-2-ethylphenyl]methanol |
| SMILES | CCc1c(CO)cccc1Nc1ccnc2cc(OCCCN(C)C)c(OC)cc12 |
| InChI | InChI=1S/C24H31N3O3/c1-5-18-17(16-28)8-6-9-20(18)26-21-10-11-25-22-15-24(23(29-4)14-19(21)22)30-13-7-12-27(2)3/h6,8-11,14-15,28H,5,7,12-13,16H2,1-4H3,(H,25,26) |
| InChIKey | LVAJJVFEDFBSAA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|