C13H18Cl2N4O2 — CID 59919174
4,5-dichloro-N-[3-(3-methylimidazolidin-1-yl)propyl]-2-nitroaniline (PubChem CID 59919174) has the molecular formula C13H18Cl2N4O2 and a molecular weight of 333.22 g/mol. Its IUPAC name is 4,5-dichloro-N-[3-(3-methylimidazolidin-1-yl)propyl]-2-nitroaniline.
| Compound Name | 4,5-dichloro-N-[3-(3-methylimidazolidin-1-yl)propyl]-2-nitroaniline |
|---|---|
| PubChem CID | 59919174 |
| Molecular Formula | C13H18Cl2N4O2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 4,5-dichloro-N-[3-(3-methylimidazolidin-1-yl)propyl]-2-nitroaniline |
| SMILES | CN1CCN(CCCNc2cc(Cl)c(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H18Cl2N4O2/c1-17-5-6-18(9-17)4-2-3-16-12-7-10(14)11(15)8-13(12)19(20)21/h7-8,16H,2-6,9H2,1H3 |
| InChIKey | HGDPOYNLNASZAB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|