C20H26N4O4S — CID 110194470
1-N-(3,5-dimethylphenyl)-3-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-nitrobenzene-1,3-diamine (PubChem CID 110194470) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is 1-N-(3,5-dimethylphenyl)-3-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-nitrobenzene-1,3-diamine.
| Compound Name | 1-N-(3,5-dimethylphenyl)-3-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 110194470 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-N-(3,5-dimethylphenyl)-3-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-nitrobenzene-1,3-diamine |
| SMILES | Cc1cc(C)cc(Nc2ccc([N+](=O)[O-])c(NCCN3CCS(=O)(=O)CC3)c2)c1 |
| InChI | InChI=1S/C20H26N4O4S/c1-15-11-16(2)13-18(12-15)22-17-3-4-20(24(25)26)19(14-17)21-5-6-23-7-9-29(27,28)10-8-23/h3-4,11-14,21-22H,5-10H2,1-2H3 |
| InChIKey | XAWKZIUVVISABK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|