C12H19NO2S — CID 166090798
ethane;2-(3-methylphenyl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 166090798) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is ethane;2-(3-methylphenyl)-1,2-thiazolidine 1,1-dioxide.
| Compound Name | ethane;2-(3-methylphenyl)-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 166090798 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethane;2-(3-methylphenyl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | CC.Cc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C10H13NO2S.C2H6/c1-9-4-2-5-10(8-9)11-6-3-7-14(11,12)13;1-2/h2,4-5,8H,3,6-7H2,1H3;1-2H3 |
| InChIKey | UKEINZPJCJSTJY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |