C18H13NO3 — CID 12511621
2,5-dimethylchromeno[3,2-c]quinoline-6,7-dione (PubChem CID 12511621) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2,5-dimethylchromeno[3,2-c]quinoline-6,7-dione.
| Compound Name | 2,5-dimethylchromeno[3,2-c]quinoline-6,7-dione |
|---|---|
| PubChem CID | 12511621 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2,5-dimethylchromeno[3,2-c]quinoline-6,7-dione |
| SMILES | Cc1ccc2c(c1)c1oc3ccccc3c(=O)c1c(=O)n2C |
| InChI | InChI=1S/C18H13NO3/c1-10-7-8-13-12(9-10)17-15(18(21)19(13)2)16(20)11-5-3-4-6-14(11)22-17/h3-9H,1-2H3 |
| InChIKey | HKWRNRJAKCGRRV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|