C23H39N — CID 160838686
ethane;1,2,9-trimethylcarbazole (PubChem CID 160838686) has the molecular formula C23H39N and a molecular weight of 329.57 g/mol. Its IUPAC name is ethane;1,2,9-trimethylcarbazole.
| Compound Name | ethane;1,2,9-trimethylcarbazole |
|---|---|
| PubChem CID | 160838686 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | ethane;1,2,9-trimethylcarbazole |
| SMILES | CC.CC.CC.CC.Cc1ccc2c3ccccc3n(C)c2c1C |
| InChI | InChI=1S/C15H15N.4C2H6/c1-10-8-9-13-12-6-4-5-7-14(12)16(3)15(13)11(10)2;4*1-2/h4-9H,1-3H3;4*1-2H3 |
| InChIKey | SHSUXUJLERLIFY-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |