C20H33N2+ — CID 159069654
ethane;1,2,9-trimethylpyrido[3,4-b]indol-2-ium (PubChem CID 159069654) has the molecular formula C20H33N2+ and a molecular weight of 301.50 g/mol. Its IUPAC name is ethane;1,2,9-trimethylpyrido[3,4-b]indol-2-ium.
| Compound Name | ethane;1,2,9-trimethylpyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 159069654 |
| Molecular Formula | C20H33N2+ |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | ethane;1,2,9-trimethylpyrido[3,4-b]indol-2-ium |
| SMILES | CC.CC.CC.Cc1c2c(cc[n+]1C)c1ccccc1n2C |
| InChI | InChI=1S/C14H15N2.3C2H6/c1-10-14-12(8-9-15(10)2)11-6-4-5-7-13(11)16(14)3;3*1-2/h4-9H,1-3H3;3*1-2H3/q+1;;; |
| InChIKey | JZMFBFWXAQNQBV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|