C13H14N2 — CID 157487086
2,3,4-trimethylpyrrolo[3,4-b]indole (PubChem CID 157487086) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2,3,4-trimethylpyrrolo[3,4-b]indole.
| Compound Name | 2,3,4-trimethylpyrrolo[3,4-b]indole |
|---|---|
| PubChem CID | 157487086 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2,3,4-trimethylpyrrolo[3,4-b]indole |
| SMILES | Cc1c2c(cn1C)c1ccccc1n2C |
| InChI | InChI=1S/C13H14N2/c1-9-13-11(8-14(9)2)10-6-4-5-7-12(10)15(13)3/h4-8H,1-3H3 |
| InChIKey | ZVBUSESVZFXXAP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |