About ethane;9-methylcarbazol-1-amine
ethane;9-methylcarbazol-1-amine (PubChem CID 142426342) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;9-methylcarbazol-1-amine.
Molecular Properties
| Compound Name | ethane;9-methylcarbazol-1-amine |
| PubChem CID | 142426342 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | ethane;9-methylcarbazol-1-amine |
| SMILES | CC.Cn1c2ccccc2c2cccc(N)c21 |
| InChI | InChI=1S/C13H12N2.C2H6/c1-15-12-8-3-2-5-9(12)10-6-4-7-11(14)13(10)15;1-2/h2-8H,14H2,1H3;1-2H3 |
| InChIKey | JELLERUSOYHCJY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;9-methylcarbazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-methylcarbazol-1-amine?
The IUPAC name of ethane;9-methylcarbazol-1-amine (CID 142426342) is ethane;9-methylcarbazol-1-amine.
What is the SMILES notation for ethane;9-methylcarbazol-1-amine?
The canonical SMILES for ethane;9-methylcarbazol-1-amine is CC.Cn1c2ccccc2c2cccc(N)c21.
What is the InChIKey of ethane;9-methylcarbazol-1-amine?
The InChIKey is JELLERUSOYHCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2.C2H6/c1-15-12-8-3-2-5-9(12)10-6-4-7-11(14)13(10)15;1-2/h2-8H,14H2,1H3;1-2H3.
What are the key properties of ethane;9-methylcarbazol-1-amine?
ethane;9-methylcarbazol-1-amine has a molecular weight of 226.32 g/mol, XLogP of 3.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-methylcarbazol-1-amine is sourced from PubChem (CID 142426342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).