C18H16N2O — CID 5037815
5,6,11-trimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium (PubChem CID 5037815) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 5,6,11-trimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium.
| Compound Name | 5,6,11-trimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium |
|---|---|
| PubChem CID | 5037815 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 5,6,11-trimethyl-2-oxidopyrido[4,3-b]carbazol-2-ium |
| SMILES | Cc1c2c[n+]([O-])ccc2c(C)c2c1c1ccccc1n2C |
| InChI | InChI=1S/C18H16N2O/c1-11-15-10-20(21)9-8-13(15)12(2)18-17(11)14-6-4-5-7-16(14)19(18)3/h4-10H,1-3H3 |
| InChIKey | PVNMIZFCBVDGOP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 31.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|