C15H17N2O3S+ — CID 160523045
1,2-dimethylindole-3-sulfonic acid;pyridin-1-ium (PubChem CID 160523045) has the molecular formula C15H17N2O3S+ and a molecular weight of 305.38 g/mol. Its IUPAC name is 1,2-dimethylindole-3-sulfonic acid;pyridin-1-ium.
| Compound Name | 1,2-dimethylindole-3-sulfonic acid;pyridin-1-ium |
|---|---|
| PubChem CID | 160523045 |
| Molecular Formula | C15H17N2O3S+ |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1,2-dimethylindole-3-sulfonic acid;pyridin-1-ium |
| SMILES | Cc1c(S(=O)(=O)O)c2ccccc2n1C.c1cc[nH+]cc1 |
| InChI | InChI=1S/C10H11NO3S.C5H5N/c1-7-10(15(12,13)14)8-5-3-4-6-9(8)11(7)2;1-2-4-6-5-3-1/h3-6H,1-2H3,(H,12,13,14);1-5H/p+1 |
| InChIKey | URKVYKZBYXVHGW-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|