C16H20N2O4S — CID 122070303
1-(1,2-dimethylindol-3-yl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 122070303) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(1,2-dimethylindol-3-yl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 1-(1,2-dimethylindol-3-yl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122070303 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-(1,2-dimethylindol-3-yl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | Cc1c(S(=O)(=O)N2CCCC(C(=O)O)C2)c2ccccc2n1C |
| InChI | InChI=1S/C16H20N2O4S/c1-11-15(13-7-3-4-8-14(13)17(11)2)23(21,22)18-9-5-6-12(10-18)16(19)20/h3-4,7-8,12H,5-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | UTBXQMYSHRVEDF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |